C34H37N3O2 — CID 139177864
2-[N-[2-[2-[[(2-hydroxy-3,5-dimethylphenyl)-phenylmethylidene]amino]ethylamino]ethyl]-C-phenylcarbonimidoyl]-4,6-dimethylphenol (PubChem CID 139177864) has the molecular formula C34H37N3O2 and a molecular weight of 519.69 g/mol. Its IUPAC name is 2-[N-[2-[2-[[(2-hydroxy-3,5-dimethylphenyl)-phenylmethylidene]amino]ethylamino]ethyl]-C-phenylcarbonimidoyl]-4,6-dimethylphenol.
| Compound Name | 2-[N-[2-[2-[[(2-hydroxy-3,5-dimethylphenyl)-phenylmethylidene]amino]ethylamino]ethyl]-C-phenylcarbonimidoyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 139177864 |
| Molecular Formula | C34H37N3O2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 2-[N-[2-[2-[[(2-hydroxy-3,5-dimethylphenyl)-phenylmethylidene]amino]ethylamino]ethyl]-C-phenylcarbonimidoyl]-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(/C(=N/CCNCC/N=C(\c2ccccc2)c2cc(C)cc(C)c2O)c2ccccc2)c1 |
| InChI | InChI=1S/C34H37N3O2/c1-23-19-25(3)33(38)29(21-23)31(27-11-7-5-8-12-27)36-17-15-35-16-18-37-32(28-13-9-6-10-14-28)30-22-24(2)20-26(4)34(30)39/h5-14,19-22,35,38-39H,15-18H2,1-4H3/b36-31+,37-32+ |
| InChIKey | MXMDUVKQFASXTP-NBTMAVPQSA-N |
| XLogP | 6.30 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|