C37H34N2OSe2 — CID 136744282
4-methyl-2,6-bis[C-phenyl-N-(2-phenylselanylethyl)carbonimidoyl]phenol (PubChem CID 136744282) has the molecular formula C37H34N2OSe2 and a molecular weight of 680.61 g/mol. Its IUPAC name is 4-methyl-2,6-bis[C-phenyl-N-(2-phenylselanylethyl)carbonimidoyl]phenol.
| Compound Name | 4-methyl-2,6-bis[C-phenyl-N-(2-phenylselanylethyl)carbonimidoyl]phenol |
|---|---|
| PubChem CID | 136744282 |
| Molecular Formula | C37H34N2OSe2 |
| Molecular Weight | 680.61 g/mol |
| Exact Mass | 682.10 |
| IUPAC Name | 4-methyl-2,6-bis[C-phenyl-N-(2-phenylselanylethyl)carbonimidoyl]phenol |
| SMILES | Cc1cc(/C(=N/CC[Se]c2ccccc2)c2ccccc2)c(O)c(/C(=N/CC[Se]c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C37H34N2OSe2/c1-28-26-33(35(29-14-6-2-7-15-29)38-22-24-41-31-18-10-4-11-19-31)37(40)34(27-28)36(30-16-8-3-9-17-30)39-23-25-42-32-20-12-5-13-21-32/h2-21,26-27,40H,22-25H2,1H3/b38-35+,39-36+ |
| InChIKey | GPFYCTKWCKSXCL-KDOJJKACSA-N |
| XLogP | 6.27 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|