C19H20NNaO3 — CID 135770205
sodium 6-[[(2-hydroxyphenyl)-phenylmethylidene]amino]hexanoate (PubChem CID 135770205) has the molecular formula C19H20NNaO3 and a molecular weight of 333.36 g/mol. Its IUPAC name is sodium 6-[[(2-hydroxyphenyl)-phenylmethylidene]amino]hexanoate.
| Compound Name | sodium 6-[[(2-hydroxyphenyl)-phenylmethylidene]amino]hexanoate |
|---|---|
| PubChem CID | 135770205 |
| Molecular Formula | C19H20NNaO3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | sodium 6-[[(2-hydroxyphenyl)-phenylmethylidene]amino]hexanoate |
| SMILES | O=C([O-])CCCCC/N=C(\c1ccccc1)c1ccccc1O.[Na+] |
| InChI | InChI=1S/C19H21NO3.Na/c21-17-12-7-6-11-16(17)19(15-9-3-1-4-10-15)20-14-8-2-5-13-18(22)23;/h1,3-4,6-7,9-12,21H,2,5,8,13-14H2,(H,22,23);/q;+1/p-1/b20-19+; |
| InChIKey | IHUPYCVRFNXTIJ-RZLHGTIFSA-M |
| XLogP | -0.46 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|