C17H14F2NNaO3 — CID 135624084
sodium 4-[[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methylidene]amino]butanoate (PubChem CID 135624084) has the molecular formula C17H14F2NNaO3 and a molecular weight of 341.29 g/mol. Its IUPAC name is sodium 4-[[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methylidene]amino]butanoate.
| Compound Name | sodium 4-[[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 135624084 |
| Molecular Formula | C17H14F2NNaO3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | sodium 4-[[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methylidene]amino]butanoate |
| SMILES | O=C([O-])CCC/N=C(\c1ccc(F)cc1)c1cc(F)ccc1O.[Na+] |
| InChI | InChI=1S/C17H15F2NO3.Na/c18-12-5-3-11(4-6-12)17(20-9-1-2-16(22)23)14-10-13(19)7-8-15(14)21;/h3-8,10,21H,1-2,9H2,(H,22,23);/q;+1/p-1/b20-17+; |
| InChIKey | GHDYMFXPHVYHKB-SJEOTZHBSA-M |
| XLogP | -0.96 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|