C17H15FNNaO3 — CID 135624088
sodium 4-[[(2-fluorophenyl)-(2-hydroxyphenyl)methylidene]amino]butanoate (PubChem CID 135624088) has the molecular formula C17H15FNNaO3 and a molecular weight of 323.30 g/mol. Its IUPAC name is sodium 4-[[(2-fluorophenyl)-(2-hydroxyphenyl)methylidene]amino]butanoate.
| Compound Name | sodium 4-[[(2-fluorophenyl)-(2-hydroxyphenyl)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 135624088 |
| Molecular Formula | C17H15FNNaO3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | sodium 4-[[(2-fluorophenyl)-(2-hydroxyphenyl)methylidene]amino]butanoate |
| SMILES | O=C([O-])CCC/N=C(/c1ccccc1O)c1ccccc1F.[Na+] |
| InChI | InChI=1S/C17H16FNO3.Na/c18-14-8-3-1-6-12(14)17(19-11-5-10-16(21)22)13-7-2-4-9-15(13)20;/h1-4,6-9,20H,5,10-11H2,(H,21,22);/q;+1/p-1/b19-17+; |
| InChIKey | FYPAEEJDPVDSPK-ZJSKVYKZSA-M |
| XLogP | -1.10 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|