C26H32CaN2O6 — CID 101304485
calcium;6-benzamidohexanoic acid;6-[[oxido(phenyl)methylidene]amino]hexanoate (PubChem CID 101304485) has the molecular formula C26H32CaN2O6 and a molecular weight of 508.63 g/mol. Its IUPAC name is calcium;6-benzamidohexanoic acid;6-[[oxido(phenyl)methylidene]amino]hexanoate.
| Compound Name | calcium;6-benzamidohexanoic acid;6-[[oxido(phenyl)methylidene]amino]hexanoate |
|---|---|
| PubChem CID | 101304485 |
| Molecular Formula | C26H32CaN2O6 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | calcium;6-benzamidohexanoic acid;6-[[oxido(phenyl)methylidene]amino]hexanoate |
| SMILES | O=C(O)CCCCCNC(=O)c1ccccc1.O=C([O-])CCCCC/N=C(\[O-])c1ccccc1.[Ca+2] |
| InChI | InChI=1S/2C13H17NO3.Ca/c2*15-12(16)9-5-2-6-10-14-13(17)11-7-3-1-4-8-11;/h2*1,3-4,7-8H,2,5-6,9-10H2,(H,14,17)(H,15,16);/q;;+2/p-2 |
| InChIKey | ONYVNXIPZMRTSG-UHFFFAOYSA-L |
| XLogP | 1.78 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|