C16H16Cl2N2 — CID 154269566
4-chloro-2-[N-(2-chloroethyl)-C-phenylcarbonimidoyl]-N-methylaniline (PubChem CID 154269566) has the molecular formula C16H16Cl2N2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 4-chloro-2-[N-(2-chloroethyl)-C-phenylcarbonimidoyl]-N-methylaniline.
| Compound Name | 4-chloro-2-[N-(2-chloroethyl)-C-phenylcarbonimidoyl]-N-methylaniline |
|---|---|
| PubChem CID | 154269566 |
| Molecular Formula | C16H16Cl2N2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-chloro-2-[N-(2-chloroethyl)-C-phenylcarbonimidoyl]-N-methylaniline |
| SMILES | CNc1ccc(Cl)cc1/C(=N/CCCl)c1ccccc1 |
| InChI | InChI=1S/C16H16Cl2N2/c1-19-15-8-7-13(18)11-14(15)16(20-10-9-17)12-5-3-2-4-6-12/h2-8,11,19H,9-10H2,1H3/b20-16+ |
| InChIKey | CPYAXFMPYUJUPL-CAPFRKAQSA-N |
| XLogP | 4.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|