C44H46Cl2N4O2S2 — CID 139091457
(NE,R)-N-[[5-chloro-2-(methylamino)phenyl]-naphthalen-2-ylmethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 139091457) has the molecular formula C44H46Cl2N4O2S2 and a molecular weight of 797.92 g/mol. Its IUPAC name is (NE,R)-N-[[5-chloro-2-(methylamino)phenyl]-naphthalen-2-ylmethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[[5-chloro-2-(methylamino)phenyl]-naphthalen-2-ylmethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 139091457 |
| Molecular Formula | C44H46Cl2N4O2S2 |
| Molecular Weight | 797.92 g/mol |
| Exact Mass | 796.24 |
| IUPAC Name | (NE,R)-N-[[5-chloro-2-(methylamino)phenyl]-naphthalen-2-ylmethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CNc1ccc(Cl)cc1/C(=N/[S@](=O)C(C)(C)C)c1ccc2ccccc2c1.CNc1ccc(Cl)cc1/C(=N/[S@](=O)C(C)(C)C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/2C22H23ClN2OS/c2*1-22(2,3)27(26)25-21(19-14-18(23)11-12-20(19)24-4)17-10-9-15-7-5-6-8-16(15)13-17/h2*5-14,24H,1-4H3/b2*25-21+/t2*27-/m11/s1 |
| InChIKey | SMMMFKABNWRWPY-VCDKYQCVSA-N |
| XLogP | 11.67 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.92 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|