C32H50Cl2N4O2S2 — CID 139091843
(NZ,R)-N-[1-[5-chloro-2-(methylamino)phenyl]-2,2-dimethylpropylidene]-2-methylpropane-2-sulfinamide (PubChem CID 139091843) has the molecular formula C32H50Cl2N4O2S2 and a molecular weight of 657.82 g/mol. Its IUPAC name is (NZ,R)-N-[1-[5-chloro-2-(methylamino)phenyl]-2,2-dimethylpropylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ,R)-N-[1-[5-chloro-2-(methylamino)phenyl]-2,2-dimethylpropylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 139091843 |
| Molecular Formula | C32H50Cl2N4O2S2 |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | (NZ,R)-N-[1-[5-chloro-2-(methylamino)phenyl]-2,2-dimethylpropylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CNc1ccc(Cl)cc1/C(=N\[S@](=O)C(C)(C)C)C(C)(C)C.CNc1ccc(Cl)cc1/C(=N\[S@](=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/2C16H25ClN2OS/c2*1-15(2,3)14(19-21(20)16(4,5)6)12-10-11(17)8-9-13(12)18-7/h2*8-10,18H,1-7H3/b2*19-14+/t2*21-/m11/s1 |
| InChIKey | WMCOOWUWALBQHE-YBMXNWGGSA-N |
| XLogP | 9.36 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|