C12H15Cl2NOS — CID 142732732
N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 142732732) has the molecular formula C12H15Cl2NOS and a molecular weight of 292.23 g/mol. Its IUPAC name is N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 142732732 |
| Molecular Formula | C12H15Cl2NOS |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(=NS(=O)C(C)(C)C)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NOS/c1-8(15-17(16)12(2,3)4)9-5-10(13)7-11(14)6-9/h5-7H,1-4H3 |
| InChIKey | VYJPJMZWOCGPNK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|