C14H20ClN3 — CID 91415552
4-chloro-N-methyl-2-[(Z)-C-methyl-N-piperidin-1-ylcarbonimidoyl]aniline (PubChem CID 91415552) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 4-chloro-N-methyl-2-[(Z)-C-methyl-N-piperidin-1-ylcarbonimidoyl]aniline.
| Compound Name | 4-chloro-N-methyl-2-[(Z)-C-methyl-N-piperidin-1-ylcarbonimidoyl]aniline |
|---|---|
| PubChem CID | 91415552 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-chloro-N-methyl-2-[(Z)-C-methyl-N-piperidin-1-ylcarbonimidoyl]aniline |
| SMILES | CNc1ccc(Cl)cc1/C(C)=N\N1CCCCC1 |
| InChI | InChI=1S/C14H20ClN3/c1-11(17-18-8-4-3-5-9-18)13-10-12(15)6-7-14(13)16-2/h6-7,10,16H,3-5,8-9H2,1-2H3/b17-11- |
| InChIKey | OGHJWIZDLXVFKF-BOPFTXTBSA-N |
| XLogP | 3.59 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|