C16H15ClN4 — CID 91391207
2-[(Z)-N-(benzimidazol-1-yl)-C-methylcarbonimidoyl]-4-chloro-N-methylaniline (PubChem CID 91391207) has the molecular formula C16H15ClN4 and a molecular weight of 298.78 g/mol. Its IUPAC name is 2-[(Z)-N-(benzimidazol-1-yl)-C-methylcarbonimidoyl]-4-chloro-N-methylaniline.
| Compound Name | 2-[(Z)-N-(benzimidazol-1-yl)-C-methylcarbonimidoyl]-4-chloro-N-methylaniline |
|---|---|
| PubChem CID | 91391207 |
| Molecular Formula | C16H15ClN4 |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-[(Z)-N-(benzimidazol-1-yl)-C-methylcarbonimidoyl]-4-chloro-N-methylaniline |
| SMILES | CNc1ccc(Cl)cc1/C(C)=N\n1cnc2ccccc21 |
| InChI | InChI=1S/C16H15ClN4/c1-11(13-9-12(17)7-8-14(13)18-2)20-21-10-19-15-5-3-4-6-16(15)21/h3-10,18H,1-2H3/b20-11- |
| InChIKey | LKBLCUZVIHNBRA-JAIQZWGSSA-N |
| XLogP | 4.00 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|