C17H19Cl2N3 — CID 91291692
4-chloro-2-[(Z)-N-(4-chloro-N-ethylanilino)-C-methylcarbonimidoyl]-N-methylaniline (PubChem CID 91291692) has the molecular formula C17H19Cl2N3 and a molecular weight of 336.27 g/mol. Its IUPAC name is 4-chloro-2-[(Z)-N-(4-chloro-N-ethylanilino)-C-methylcarbonimidoyl]-N-methylaniline.
| Compound Name | 4-chloro-2-[(Z)-N-(4-chloro-N-ethylanilino)-C-methylcarbonimidoyl]-N-methylaniline |
|---|---|
| PubChem CID | 91291692 |
| Molecular Formula | C17H19Cl2N3 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-chloro-2-[(Z)-N-(4-chloro-N-ethylanilino)-C-methylcarbonimidoyl]-N-methylaniline |
| SMILES | CCN(/N=C(/C)c1cc(Cl)ccc1NC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2N3/c1-4-22(15-8-5-13(18)6-9-15)21-12(2)16-11-14(19)7-10-17(16)20-3/h5-11,20H,4H2,1-3H3/b21-12- |
| InChIKey | NMVXISIHBFYCDA-MTJSOVHGSA-N |
| XLogP | 5.29 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|