About 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline
4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline (PubChem CID 58987753) has the molecular formula C17H20ClN3
and a molecular weight of 301.82 g/mol. Its IUPAC name is 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline.
Molecular Properties
| Compound Name | 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline |
| PubChem CID | 58987753 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline |
| SMILES | CNc1ccc(Cl)cc1/C(C)=N/N(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H20ClN3/c1-12-5-8-15(9-6-12)21(4)20-13(2)16-11-14(18)7-10-17(16)19-3/h5-11,19H,1-4H3/b20-13+ |
| InChIKey | YGDVDWPKIUVBKD-DEDYPNTBSA-N |
| XLogP | 4.55 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline?
The IUPAC name of 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline (CID 58987753) is 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline.
What is the SMILES notation for 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline?
The canonical SMILES for 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline is CNc1ccc(Cl)cc1/C(C)=N/N(C)c1ccc(C)cc1.
What is the InChIKey of 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline?
The InChIKey is YGDVDWPKIUVBKD-DEDYPNTBSA-N. The full InChI is InChI=1S/C17H20ClN3/c1-12-5-8-15(9-6-12)21(4)20-13(2)16-11-14(18)7-10-17(16)19-3/h5-11,19H,1-4H3/b20-13+.
What are the key properties of 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline?
4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline has a molecular weight of 301.82 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(E)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]-N-methylaniline is sourced from PubChem (CID 58987753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).