C16H16Cl3N3 — CID 90742179
2,3-dichloro-N-[(Z)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-N-methylaniline (PubChem CID 90742179) has the molecular formula C16H16Cl3N3 and a molecular weight of 356.68 g/mol. Its IUPAC name is 2,3-dichloro-N-[(Z)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-N-methylaniline.
| Compound Name | 2,3-dichloro-N-[(Z)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-N-methylaniline |
|---|---|
| PubChem CID | 90742179 |
| Molecular Formula | C16H16Cl3N3 |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2,3-dichloro-N-[(Z)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-N-methylaniline |
| SMILES | CNc1ccc(Cl)cc1/C(C)=N\N(C)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H16Cl3N3/c1-10(12-9-11(17)7-8-14(12)20-2)21-22(3)15-6-4-5-13(18)16(15)19/h4-9,20H,1-3H3/b21-10- |
| InChIKey | GROXCZXFSUESTG-FBHDLOMBSA-N |
| XLogP | 5.55 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|