C16H17Cl2N3 — CID 90885434
4-chloro-2-[(Z)-N-(4-chloro-N-methylanilino)-C-methylcarbonimidoyl]-N-methylaniline (PubChem CID 90885434) has the molecular formula C16H17Cl2N3 and a molecular weight of 322.24 g/mol. Its IUPAC name is 4-chloro-2-[(Z)-N-(4-chloro-N-methylanilino)-C-methylcarbonimidoyl]-N-methylaniline.
| Compound Name | 4-chloro-2-[(Z)-N-(4-chloro-N-methylanilino)-C-methylcarbonimidoyl]-N-methylaniline |
|---|---|
| PubChem CID | 90885434 |
| Molecular Formula | C16H17Cl2N3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-chloro-2-[(Z)-N-(4-chloro-N-methylanilino)-C-methylcarbonimidoyl]-N-methylaniline |
| SMILES | CNc1ccc(Cl)cc1/C(C)=N\N(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17Cl2N3/c1-11(15-10-13(18)6-9-16(15)19-2)20-21(3)14-7-4-12(17)5-8-14/h4-10,19H,1-3H3/b20-11- |
| InChIKey | ZVCWNLNPMPLEEN-JAIQZWGSSA-N |
| XLogP | 4.90 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|