C17H18Cl3N3 — CID 58987820
3,4-dichloro-N-[(E)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-N-ethylaniline (PubChem CID 58987820) has the molecular formula C17H18Cl3N3 and a molecular weight of 370.71 g/mol. Its IUPAC name is 3,4-dichloro-N-[(E)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-N-ethylaniline.
| Compound Name | 3,4-dichloro-N-[(E)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-N-ethylaniline |
|---|---|
| PubChem CID | 58987820 |
| Molecular Formula | C17H18Cl3N3 |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 3,4-dichloro-N-[(E)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-N-ethylaniline |
| SMILES | CCN(/N=C(\C)c1cc(Cl)ccc1NC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl3N3/c1-4-23(13-6-7-15(19)16(20)10-13)22-11(2)14-9-12(18)5-8-17(14)21-3/h5-10,21H,4H2,1-3H3/b22-11+ |
| InChIKey | AYTDUKLTEBNHKF-SSDVNMTOSA-N |
| XLogP | 5.94 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|