C18H21ClFN3 — CID 58987688
4-chloro-2-[(E)-N-(2-fluoro-N-propylanilino)-C-methylcarbonimidoyl]-N-methylaniline (PubChem CID 58987688) has the molecular formula C18H21ClFN3 and a molecular weight of 333.84 g/mol. Its IUPAC name is 4-chloro-2-[(E)-N-(2-fluoro-N-propylanilino)-C-methylcarbonimidoyl]-N-methylaniline.
| Compound Name | 4-chloro-2-[(E)-N-(2-fluoro-N-propylanilino)-C-methylcarbonimidoyl]-N-methylaniline |
|---|---|
| PubChem CID | 58987688 |
| Molecular Formula | C18H21ClFN3 |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-chloro-2-[(E)-N-(2-fluoro-N-propylanilino)-C-methylcarbonimidoyl]-N-methylaniline |
| SMILES | CCCN(/N=C(\C)c1cc(Cl)ccc1NC)c1ccccc1F |
| InChI | InChI=1S/C18H21ClFN3/c1-4-11-23(18-8-6-5-7-16(18)20)22-13(2)15-12-14(19)9-10-17(15)21-3/h5-10,12,21H,4,11H2,1-3H3/b22-13+ |
| InChIKey | GSSCCVSJBVCAPL-LPYMAVHISA-N |
| XLogP | 5.16 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|