C14H17ClN4O2 — CID 58987854
3-[(E)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 58987854) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is 3-[(E)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(E)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58987854 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3-[(E)-1-[5-chloro-2-(methylamino)phenyl]ethylideneamino]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CNc1ccc(Cl)cc1/C(C)=N/N1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C14H17ClN4O2/c1-8(10-7-9(15)5-6-11(10)16-4)18-19-12(20)14(2,3)17-13(19)21/h5-7,16H,1-4H3,(H,17,21)/b18-8+ |
| InChIKey | IDGKTEYDSXTKKU-QGMBQPNBSA-N |
| XLogP | 2.44 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|