C17H22ClN3 — CID 58987682
4-chloro-N-methyl-2-[(E)-C-methyl-N-piperidin-1-ylcarbonimidoyl]-N-prop-2-ynylaniline (PubChem CID 58987682) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 4-chloro-N-methyl-2-[(E)-C-methyl-N-piperidin-1-ylcarbonimidoyl]-N-prop-2-ynylaniline.
| Compound Name | 4-chloro-N-methyl-2-[(E)-C-methyl-N-piperidin-1-ylcarbonimidoyl]-N-prop-2-ynylaniline |
|---|---|
| PubChem CID | 58987682 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4-chloro-N-methyl-2-[(E)-C-methyl-N-piperidin-1-ylcarbonimidoyl]-N-prop-2-ynylaniline |
| SMILES | C#CCN(C)c1ccc(Cl)cc1/C(C)=N/N1CCCCC1 |
| InChI | InChI=1S/C17H22ClN3/c1-4-10-20(3)17-9-8-15(18)13-16(17)14(2)19-21-11-6-5-7-12-21/h1,8-9,13H,5-7,10-12H2,2-3H3/b19-14+ |
| InChIKey | JWSFJUFHNJQHNH-XMHGGMMESA-N |
| XLogP | 3.62 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|