C19H24N2O3S — CID 4065035
N-[1-(2-hydroxy-3,5-dimethylphenyl)pentylideneamino]benzenesulfonamide (PubChem CID 4065035) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[1-(2-hydroxy-3,5-dimethylphenyl)pentylideneamino]benzenesulfonamide.
| Compound Name | N-[1-(2-hydroxy-3,5-dimethylphenyl)pentylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 4065035 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[1-(2-hydroxy-3,5-dimethylphenyl)pentylideneamino]benzenesulfonamide |
| SMILES | CCCCC(=NNS(=O)(=O)c1ccccc1)c1cc(C)cc(C)c1O |
| InChI | InChI=1S/C19H24N2O3S/c1-4-5-11-18(17-13-14(2)12-15(3)19(17)22)20-21-25(23,24)16-9-7-6-8-10-16/h6-10,12-13,21-22H,4-5,11H2,1-3H3 |
| InChIKey | RAZUSMGSKICUDW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|