C18H22N2O4S — CID 135589157
N-[(E)-1-(2-hydroxy-5-methoxyphenyl)pentylideneamino]benzenesulfonamide (PubChem CID 135589157) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[(E)-1-(2-hydroxy-5-methoxyphenyl)pentylideneamino]benzenesulfonamide.
| Compound Name | N-[(E)-1-(2-hydroxy-5-methoxyphenyl)pentylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135589157 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[(E)-1-(2-hydroxy-5-methoxyphenyl)pentylideneamino]benzenesulfonamide |
| SMILES | CCCC/C(=N\NS(=O)(=O)c1ccccc1)c1cc(OC)ccc1O |
| InChI | InChI=1S/C18H22N2O4S/c1-3-4-10-17(16-13-14(24-2)11-12-18(16)21)19-20-25(22,23)15-8-6-5-7-9-15/h5-9,11-13,20-21H,3-4,10H2,1-2H3/b19-17+ |
| InChIKey | IINAMAIKQGIHIP-HTXNQAPBSA-N |
| XLogP | 3.27 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|