C38H40N2O8 — CID 4694704
[[10-benzoyloxyimino-1,10-bis(2-hydroxy-5-methoxyphenyl)decylidene]amino] benzoate (PubChem CID 4694704) has the molecular formula C38H40N2O8 and a molecular weight of 652.74 g/mol. Its IUPAC name is [[10-benzoyloxyimino-1,10-bis(2-hydroxy-5-methoxyphenyl)decylidene]amino] benzoate.
| Compound Name | [[10-benzoyloxyimino-1,10-bis(2-hydroxy-5-methoxyphenyl)decylidene]amino] benzoate |
|---|---|
| PubChem CID | 4694704 |
| Molecular Formula | C38H40N2O8 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | [[10-benzoyloxyimino-1,10-bis(2-hydroxy-5-methoxyphenyl)decylidene]amino] benzoate |
| SMILES | COc1ccc(O)c(C(CCCCCCCCC(=NOC(=O)c2ccccc2)c2cc(OC)ccc2O)=NOC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C38H40N2O8/c1-45-29-21-23-35(41)31(25-29)33(39-47-37(43)27-15-9-7-10-16-27)19-13-5-3-4-6-14-20-34(32-26-30(46-2)22-24-36(32)42)40-48-38(44)28-17-11-8-12-18-28/h7-12,15-18,21-26,41-42H,3-6,13-14,19-20H2,1-2H3 |
| InChIKey | ALFIEKPZZLOTMH-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|