C25H24N2O4S — CID 139934221
N-[[(1E,4E)-1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-ylidene]amino]benzenesulfonamide (PubChem CID 139934221) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is N-[[(1E,4E)-1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-ylidene]amino]benzenesulfonamide.
| Compound Name | N-[[(1E,4E)-1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 139934221 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-[[(1E,4E)-1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-ylidene]amino]benzenesulfonamide |
| SMILES | COc1ccc(/C=C/C(/C=C/c2ccc(OC)cc2)=NNS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O4S/c1-30-23-16-10-20(11-17-23)8-14-22(15-9-21-12-18-24(31-2)19-13-21)26-27-32(28,29)25-6-4-3-5-7-25/h3-19,27H,1-2H3/b14-8+,15-9+ |
| InChIKey | JSWQULXHXSESNZ-VOMDNODZSA-N |
| XLogP | 4.76 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|