C19H22O — CID 15629610
2-methyl-1-phenyl-2-(2,4,6-trimethylphenyl)propan-1-one (PubChem CID 15629610) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-methyl-1-phenyl-2-(2,4,6-trimethylphenyl)propan-1-one.
| Compound Name | 2-methyl-1-phenyl-2-(2,4,6-trimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 15629610 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-methyl-1-phenyl-2-(2,4,6-trimethylphenyl)propan-1-one |
| SMILES | Cc1cc(C)c(C(C)(C)C(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H22O/c1-13-11-14(2)17(15(3)12-13)19(4,5)18(20)16-9-7-6-8-10-16/h6-12H,1-5H3 |
| InChIKey | CWJPZWFOZYRPIO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |