C14H22N2O — CID 116845906
N,2-dimethyl-2-(2,4,6-trimethylphenyl)propanehydrazide (PubChem CID 116845906) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N,2-dimethyl-2-(2,4,6-trimethylphenyl)propanehydrazide.
| Compound Name | N,2-dimethyl-2-(2,4,6-trimethylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 116845906 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N,2-dimethyl-2-(2,4,6-trimethylphenyl)propanehydrazide |
| SMILES | Cc1cc(C)c(C(C)(C)C(=O)N(C)N)c(C)c1 |
| InChI | InChI=1S/C14H22N2O/c1-9-7-10(2)12(11(3)8-9)14(4,5)13(17)16(6)15/h7-8H,15H2,1-6H3 |
| InChIKey | LPBQSMSXXKWISL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|