C16H26N2O — CID 116845949
2-(4-tert-butyl-2-methylphenyl)-N,2-dimethylpropanehydrazide (PubChem CID 116845949) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-methylphenyl)-N,2-dimethylpropanehydrazide.
| Compound Name | 2-(4-tert-butyl-2-methylphenyl)-N,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 116845949 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2-(4-tert-butyl-2-methylphenyl)-N,2-dimethylpropanehydrazide |
| SMILES | Cc1cc(C(C)(C)C)ccc1C(C)(C)C(=O)N(C)N |
| InChI | InChI=1S/C16H26N2O/c1-11-10-12(15(2,3)4)8-9-13(11)16(5,6)14(19)18(7)17/h8-10H,17H2,1-7H3 |
| InChIKey | QUPXASJQVFBYTN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|