C18H19O3S- — CID 175234671
3-oxo-3-phenyl-2-(2,4,6-trimethylphenyl)propane-1-sulfinate (PubChem CID 175234671) has the molecular formula C18H19O3S- and a molecular weight of 315.41 g/mol. Its IUPAC name is 3-oxo-3-phenyl-2-(2,4,6-trimethylphenyl)propane-1-sulfinate.
| Compound Name | 3-oxo-3-phenyl-2-(2,4,6-trimethylphenyl)propane-1-sulfinate |
|---|---|
| PubChem CID | 175234671 |
| Molecular Formula | C18H19O3S- |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3-oxo-3-phenyl-2-(2,4,6-trimethylphenyl)propane-1-sulfinate |
| SMILES | Cc1cc(C)c(C(CS(=O)[O-])C(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H20O3S/c1-12-9-13(2)17(14(3)10-12)16(11-22(20)21)18(19)15-7-5-4-6-8-15/h4-10,16H,11H2,1-3H3,(H,20,21)/p-1 |
| InChIKey | AOYKOQMKUJBJOI-UHFFFAOYSA-M |
| XLogP | 3.46 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|