C17H18O5S2 — CID 175161108
1,3,5-trimethyl-2-(2-oxo-2-phenyl-1-sulfinosulfonylethyl)benzene (PubChem CID 175161108) has the molecular formula C17H18O5S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-(2-oxo-2-phenyl-1-sulfinosulfonylethyl)benzene.
| Compound Name | 1,3,5-trimethyl-2-(2-oxo-2-phenyl-1-sulfinosulfonylethyl)benzene |
|---|---|
| PubChem CID | 175161108 |
| Molecular Formula | C17H18O5S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 1,3,5-trimethyl-2-(2-oxo-2-phenyl-1-sulfinosulfonylethyl)benzene |
| SMILES | Cc1cc(C)c(C(C(=O)c2ccccc2)S(=O)(=O)S(=O)O)c(C)c1 |
| InChI | InChI=1S/C17H18O5S2/c1-11-9-12(2)15(13(3)10-11)17(24(21,22)23(19)20)16(18)14-7-5-4-6-8-14/h4-10,17H,1-3H3,(H,19,20) |
| InChIKey | MKHHTTJWNSYBLW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|