C9H12ClN3 — CID 57071675
2-(2-chloro-4,6-dimethylphenyl)guanidine (PubChem CID 57071675) has the molecular formula C9H12ClN3 and a molecular weight of 197.67 g/mol. Its IUPAC name is 2-(2-chloro-4,6-dimethylphenyl)guanidine.
| Compound Name | 2-(2-chloro-4,6-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 57071675 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-(2-chloro-4,6-dimethylphenyl)guanidine |
| SMILES | Cc1cc(C)c(N=C(N)N)c(Cl)c1 |
| InChI | InChI=1S/C9H12ClN3/c1-5-3-6(2)8(7(10)4-5)13-9(11)12/h3-4H,1-2H3,(H4,11,12,13) |
| InChIKey | NYZPPUNZGDHONR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|