C14H14Cl2N4 — CID 143121597
2-[2-amino-4-(2,6-dichlorophenyl)-6-methylphenyl]guanidine (PubChem CID 143121597) has the molecular formula C14H14Cl2N4 and a molecular weight of 309.20 g/mol. Its IUPAC name is 2-[2-amino-4-(2,6-dichlorophenyl)-6-methylphenyl]guanidine.
| Compound Name | 2-[2-amino-4-(2,6-dichlorophenyl)-6-methylphenyl]guanidine |
|---|---|
| PubChem CID | 143121597 |
| Molecular Formula | C14H14Cl2N4 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[2-amino-4-(2,6-dichlorophenyl)-6-methylphenyl]guanidine |
| SMILES | Cc1cc(-c2c(Cl)cccc2Cl)cc(N)c1N=C(N)N |
| InChI | InChI=1S/C14H14Cl2N4/c1-7-5-8(6-11(17)13(7)20-14(18)19)12-9(15)3-2-4-10(12)16/h2-6H,17H2,1H3,(H4,18,19,20) |
| InChIKey | GTGBUQMACDEHIO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|