C21H30N2 — CID 20512413
1-N,2-N-bis(2,4,6-trimethylphenyl)propane-1,2-diamine (PubChem CID 20512413) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 1-N,2-N-bis(2,4,6-trimethylphenyl)propane-1,2-diamine.
| Compound Name | 1-N,2-N-bis(2,4,6-trimethylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 20512413 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1-N,2-N-bis(2,4,6-trimethylphenyl)propane-1,2-diamine |
| SMILES | Cc1cc(C)c(NCC(C)Nc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H30N2/c1-13-8-15(3)20(16(4)9-13)22-12-19(7)23-21-17(5)10-14(2)11-18(21)6/h8-11,19,22-23H,12H2,1-7H3 |
| InChIKey | ZCGAIFXUKWTBNU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |