C44H52ClN4Ru+ — CID 135472029
1-N',2-N'-bis(4-methylphenyl)-1-N,2-N-bis(2,4,6-trimethylphenyl)ethanediimidamide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene (PubChem CID 135472029) has the molecular formula C44H52ClN4Ru+ and a molecular weight of 773.45 g/mol. Its IUPAC name is 1-N',2-N'-bis(4-methylphenyl)-1-N,2-N-bis(2,4,6-trimethylphenyl)ethanediimidamide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene.
| Compound Name | 1-N',2-N'-bis(4-methylphenyl)-1-N,2-N-bis(2,4,6-trimethylphenyl)ethanediimidamide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 135472029 |
| Molecular Formula | C44H52ClN4Ru+ |
| Molecular Weight | 773.45 g/mol |
| Exact Mass | 773.29 |
| IUPAC Name | 1-N',2-N'-bis(4-methylphenyl)-1-N,2-N-bis(2,4,6-trimethylphenyl)ethanediimidamide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene |
| SMILES | Cc1ccc(/N=C(Nc2c(C)cc(C)cc2C)/C(=N/c2ccc(C)cc2)Nc2c(C)cc(C)cc2C)cc1.Cc1ccc(C(C)C)cc1.Cl[Ru+] |
| InChI | InChI=1S/C34H38N4.C10H14.ClH.Ru/c1-21-9-13-29(14-10-21)35-33(37-31-25(5)17-23(3)18-26(31)6)34(36-30-15-11-22(2)12-16-30)38-32-27(7)19-24(4)20-28(32)8;1-8(2)10-6-4-9(3)5-7-10;;/h9-20H,1-8H3,(H,35,37)(H,36,38);4-8H,1-3H3;1H;/q;;;+2/p-1 |
| InChIKey | QUDOCVJAHDMZJY-UHFFFAOYSA-M |
| XLogP | 12.94 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.45 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|