C15H25N5 — CID 88755153
(1E)-1-[amino-(2,4,6-triethylanilino)methylidene]-2-methylguanidine (PubChem CID 88755153) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is (1E)-1-[amino-(2,4,6-triethylanilino)methylidene]-2-methylguanidine.
| Compound Name | (1E)-1-[amino-(2,4,6-triethylanilino)methylidene]-2-methylguanidine |
|---|---|
| PubChem CID | 88755153 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | (1E)-1-[amino-(2,4,6-triethylanilino)methylidene]-2-methylguanidine |
| SMILES | CCc1cc(CC)c(N/C(N)=N/C(N)=N/C)c(CC)c1 |
| InChI | InChI=1S/C15H25N5/c1-5-10-8-11(6-2)13(12(7-3)9-10)19-15(17)20-14(16)18-4/h8-9H,5-7H2,1-4H3,(H5,16,17,18,19,20) |
| InChIKey | SQAWVLCFZCYSCX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|