C25H36N2S — CID 156865136
1,3-bis(2,4,6-triethylphenyl)thiourea (PubChem CID 156865136) has the molecular formula C25H36N2S and a molecular weight of 396.64 g/mol. Its IUPAC name is 1,3-bis(2,4,6-triethylphenyl)thiourea.
| Compound Name | 1,3-bis(2,4,6-triethylphenyl)thiourea |
|---|---|
| PubChem CID | 156865136 |
| Molecular Formula | C25H36N2S |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 1,3-bis(2,4,6-triethylphenyl)thiourea |
| SMILES | CCc1cc(CC)c(NC(=S)Nc2c(CC)cc(CC)cc2CC)c(CC)c1 |
| InChI | InChI=1S/C25H36N2S/c1-7-17-13-19(9-3)23(20(10-4)14-17)26-25(28)27-24-21(11-5)15-18(8-2)16-22(24)12-6/h13-16H,7-12H2,1-6H3,(H2,26,27,28) |
| InChIKey | DNLJZVGXCGUBHV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|