C10H11F3N6O2 — CID 21492902
(1E)-1-[amino-[3-nitro-4-(trifluoromethyl)anilino]methylidene]-2-methylguanidine (PubChem CID 21492902) has the molecular formula C10H11F3N6O2 and a molecular weight of 304.23 g/mol. Its IUPAC name is (1E)-1-[amino-[3-nitro-4-(trifluoromethyl)anilino]methylidene]-2-methylguanidine.
| Compound Name | (1E)-1-[amino-[3-nitro-4-(trifluoromethyl)anilino]methylidene]-2-methylguanidine |
|---|---|
| PubChem CID | 21492902 |
| Molecular Formula | C10H11F3N6O2 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (1E)-1-[amino-[3-nitro-4-(trifluoromethyl)anilino]methylidene]-2-methylguanidine |
| SMILES | C/N=C(N)/N=C(\N)Nc1ccc(C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11F3N6O2/c1-16-8(14)18-9(15)17-5-2-3-6(10(11,12)13)7(4-5)19(20)21/h2-4H,1H3,(H5,14,15,16,17,18) |
| InChIKey | HOOVGZBXJCESOD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 131.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|