C9H8F3N5O2 — CID 87880613
2-[(E)-[3-nitro-4-(trifluoromethyl)phenyl]methylideneamino]guanidine (PubChem CID 87880613) has the molecular formula C9H8F3N5O2 and a molecular weight of 275.19 g/mol. Its IUPAC name is 2-[(E)-[3-nitro-4-(trifluoromethyl)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[3-nitro-4-(trifluoromethyl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 87880613 |
| Molecular Formula | C9H8F3N5O2 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-[(E)-[3-nitro-4-(trifluoromethyl)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1ccc(C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H8F3N5O2/c10-9(11,12)6-2-1-5(3-7(6)17(18)19)4-15-16-8(13)14/h1-4H,(H4,13,14,16)/b15-4+ |
| InChIKey | QNYAOPAPDBMWCG-SYZQJQIISA-N |
| XLogP | 1.22 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|