C11H15N5O3 — CID 110539913
2-[(Z)-(3-nitro-4-propoxyphenyl)methylideneamino]guanidine (PubChem CID 110539913) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-[(Z)-(3-nitro-4-propoxyphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(Z)-(3-nitro-4-propoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 110539913 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-[(Z)-(3-nitro-4-propoxyphenyl)methylideneamino]guanidine |
| SMILES | CCCOc1ccc(/C=N\N=C(N)N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N5O3/c1-2-5-19-10-4-3-8(6-9(10)16(17)18)7-14-15-11(12)13/h3-4,6-7H,2,5H2,1H3,(H4,12,13,15)/b14-7- |
| InChIKey | YJOWIKCPWVALCK-AUWJEWJLSA-N |
| XLogP | 0.99 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|