C9H12ClN5O3 — CID 118705656
2-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 118705656) has the molecular formula C9H12ClN5O3 and a molecular weight of 273.68 g/mol. Its IUPAC name is 2-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 118705656 |
| Molecular Formula | C9H12ClN5O3 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | COc1ccc(/C=N/N=C(N)N)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C9H11N5O3.ClH/c1-17-8-3-2-6(4-7(8)14(15)16)5-12-13-9(10)11;/h2-5H,1H3,(H4,10,11,13);1H/b12-5+; |
| InChIKey | FJRVIUFTTHSNPZ-NKPNRJPBSA-N |
| XLogP | 0.63 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|