C15H11F3N6O5 — CID 168591258
2-[[4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]guanidine (PubChem CID 168591258) has the molecular formula C15H11F3N6O5 and a molecular weight of 412.28 g/mol. Its IUPAC name is 2-[[4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591258 |
| Molecular Formula | C15H11F3N6O5 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-[[4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1ccc(Oc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11F3N6O5/c16-15(17,18)9-5-11(23(25)26)13(12(6-9)24(27)28)29-10-3-1-8(2-4-10)7-21-22-14(19)20/h1-7H,(H4,19,20,22) |
| InChIKey | YQFIXZIWIRYZHN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 172.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|