C22H22F3N3O4 — CID 30214792
4-tert-butyl-N-[4-(cyclopropanecarbonylamino)-2-(trifluoromethyl)phenyl]-3-nitrobenzamide (PubChem CID 30214792) has the molecular formula C22H22F3N3O4 and a molecular weight of 449.43 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(cyclopropanecarbonylamino)-2-(trifluoromethyl)phenyl]-3-nitrobenzamide.
| Compound Name | 4-tert-butyl-N-[4-(cyclopropanecarbonylamino)-2-(trifluoromethyl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 30214792 |
| Molecular Formula | C22H22F3N3O4 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 4-tert-butyl-N-[4-(cyclopropanecarbonylamino)-2-(trifluoromethyl)phenyl]-3-nitrobenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(NC(=O)C3CC3)cc2C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H22F3N3O4/c1-21(2,3)15-8-6-13(10-18(15)28(31)32)20(30)27-17-9-7-14(11-16(17)22(23,24)25)26-19(29)12-4-5-12/h6-12H,4-5H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | JAJDLBHRFAQWTA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|