C19H15ClF3N3O5 — CID 55782239
N-[4-[(4-chloro-3-nitrobenzoyl)amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide (PubChem CID 55782239) has the molecular formula C19H15ClF3N3O5 and a molecular weight of 457.79 g/mol. Its IUPAC name is N-[4-[(4-chloro-3-nitrobenzoyl)amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide.
| Compound Name | N-[4-[(4-chloro-3-nitrobenzoyl)amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 55782239 |
| Molecular Formula | C19H15ClF3N3O5 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-[4-[(4-chloro-3-nitrobenzoyl)amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)C2CCCO2)cc1C(F)(F)F)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15ClF3N3O5/c20-13-5-3-10(8-15(13)26(29)30)17(27)25-14-6-4-11(9-12(14)19(21,22)23)24-18(28)16-2-1-7-31-16/h3-6,8-9,16H,1-2,7H2,(H,24,28)(H,25,27) |
| InChIKey | RTWZDIXSNBSFLC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|