C24H22F3N3O5 — CID 51958687
(2R)-N-[4-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide (PubChem CID 51958687) has the molecular formula C24H22F3N3O5 and a molecular weight of 489.45 g/mol. Its IUPAC name is (2R)-N-[4-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[4-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 51958687 |
| Molecular Formula | C24H22F3N3O5 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | (2R)-N-[4-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)[C@H]2CCCO2)cc1C(F)(F)F)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C24H22F3N3O5/c25-24(26,27)17-12-16(28-23(34)19-2-1-11-35-19)7-8-18(17)29-22(33)15-5-3-14(4-6-15)13-30-20(31)9-10-21(30)32/h3-8,12,19H,1-2,9-11,13H2,(H,28,34)(H,29,33)/t19-/m1/s1 |
| InChIKey | PPNDKTDRQJYECL-LJQANCHMSA-N |
| XLogP | 3.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|