C24H18F3N3O5 — CID 46698448
N-[4-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 46698448) has the molecular formula C24H18F3N3O5 and a molecular weight of 485.42 g/mol. Its IUPAC name is N-[4-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46698448 |
| Molecular Formula | C24H18F3N3O5 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-[4-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccco2)cc1C(F)(F)F)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C24H18F3N3O5/c25-24(26,27)17-12-16(28-23(34)19-2-1-11-35-19)7-8-18(17)29-22(33)15-5-3-14(4-6-15)13-30-20(31)9-10-21(30)32/h1-8,11-12H,9-10,13H2,(H,28,34)(H,29,33) |
| InChIKey | NAAXYVVWCRPJRU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|