C24H25F3N4O3 — CID 55787869
4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 55787869) has the molecular formula C24H25F3N4O3 and a molecular weight of 474.48 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55787869 |
| Molecular Formula | C24H25F3N4O3 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3ccc(CN4C(=O)CCC4=O)cc3)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H25F3N4O3/c1-29-10-12-30(13-11-29)18-6-7-20(19(14-18)24(25,26)27)28-23(34)17-4-2-16(3-5-17)15-31-21(32)8-9-22(31)33/h2-7,14H,8-13,15H2,1H3,(H,28,34) |
| InChIKey | HQXZPHQYKADXAK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|