C17H24F3N3OS — CID 55880920
N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-2-propylsulfanylacetamide (PubChem CID 55880920) has the molecular formula C17H24F3N3OS and a molecular weight of 375.46 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-2-propylsulfanylacetamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-2-propylsulfanylacetamide |
|---|---|
| PubChem CID | 55880920 |
| Molecular Formula | C17H24F3N3OS |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-2-propylsulfanylacetamide |
| SMILES | CCCSCC(=O)Nc1ccc(N2CCN(C)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H24F3N3OS/c1-3-10-25-12-16(24)21-15-5-4-13(11-14(15)17(18,19)20)23-8-6-22(2)7-9-23/h4-5,11H,3,6-10,12H2,1-2H3,(H,21,24) |
| InChIKey | HAKZOGSZXDRSHW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|