C20H30F3N3O — CID 55788373
N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]octanamide (PubChem CID 55788373) has the molecular formula C20H30F3N3O and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]octanamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]octanamide |
|---|---|
| PubChem CID | 55788373 |
| Molecular Formula | C20H30F3N3O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(N2CCN(C)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H30F3N3O/c1-3-4-5-6-7-8-19(27)24-18-10-9-16(15-17(18)20(21,22)23)26-13-11-25(2)12-14-26/h9-10,15H,3-8,11-14H2,1-2H3,(H,24,27) |
| InChIKey | JEJNVIZIQDQIAK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|