C20H21ClF3N3O2 — CID 55788209
5-chloro-2-methoxy-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 55788209) has the molecular formula C20H21ClF3N3O2 and a molecular weight of 427.85 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55788209 |
| Molecular Formula | C20H21ClF3N3O2 |
| Molecular Weight | 427.85 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 5-chloro-2-methoxy-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1ccc(N2CCN(C)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H21ClF3N3O2/c1-26-7-9-27(10-8-26)14-4-5-17(16(12-14)20(22,23)24)25-19(28)15-11-13(21)3-6-18(15)29-2/h3-6,11-12H,7-10H2,1-2H3,(H,25,28) |
| InChIKey | DWQZQGMGQDDFLA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |