C21H23ClF3N3O2 — CID 55788115
2-(3-chlorophenoxy)-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]propanamide (PubChem CID 55788115) has the molecular formula C21H23ClF3N3O2 and a molecular weight of 441.88 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55788115 |
| Molecular Formula | C21H23ClF3N3O2 |
| Molecular Weight | 441.88 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(Oc1cccc(Cl)c1)C(=O)Nc1ccc(N2CCN(C)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H23ClF3N3O2/c1-14(30-17-5-3-4-15(22)12-17)20(29)26-19-7-6-16(13-18(19)21(23,24)25)28-10-8-27(2)9-11-28/h3-7,12-14H,8-11H2,1-2H3,(H,26,29) |
| InChIKey | YQPNRZCHQUVATC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |