C23H21F3N2O3 — CID 55500727
N-[4-[3-(4-ethylphenyl)propanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 55500727) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is N-[4-[3-(4-ethylphenyl)propanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[3-(4-ethylphenyl)propanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55500727 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[4-[3-(4-ethylphenyl)propanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | CCc1ccc(CCC(=O)Nc2ccc(NC(=O)c3ccco3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F3N2O3/c1-2-15-5-7-16(8-6-15)9-12-21(29)28-19-11-10-17(14-18(19)23(24,25)26)27-22(30)20-4-3-13-31-20/h3-8,10-11,13-14H,2,9,12H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | YNVVRXQGNAWCSN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |